Products 1173019-21-0
CAS 1173019-21-0 is the registry number for Methylmalonic acid-13C4, 99.6%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 50 mg, 5 mg, 25 mg, 10 mg.
2-(113C)methyl(1,2,3-13C3)propanedioic acid (CAS 1173019-21-0) is a chemical compound with the molecular formula C4H6O4 and a molecular weight of 122.059 g/mol. IUPAC name: 2-(113C)methyl(1,2,3-13C3)propanedioic acid. InChIKey: ZIYVHBGGAOATLY-JCDJMFQYSA-N.
| Molecular formula | C4H6O4 |
|---|---|
| Molecular weight | 122.059 g/mol |
| IUPAC name | 2-(113C)methyl(1,2,3-13C3)propanedioic acid |
| InChIKey | ZIYVHBGGAOATLY-JCDJMFQYSA-N |
| SMILES | [13CH3][13CH]([13C](=O)O)[13C](=O)O |
Computed by PubChem (NCBI)