CAS 1173020-50-2 appears in our catalog under these names: 3-Bromofluorobenzene-13C6, 98% 98%atom%13C, 3-Bromofluorobenzene-13C6. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 1mg, 5mg.
3-bromo-1-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 1173020-50-2) is a chemical compound with the molecular formula C6H4BrF and a molecular weight of 180.95 g/mol. IUPAC name: 3-bromo-1-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: QDFKKJYEIFBEFC-IDEBNGHGSA-N.
| Molecular formula | C6H4BrF |
|---|---|
| Molecular weight | 180.95 g/mol |
| IUPAC name | 3-bromo-1-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | QDFKKJYEIFBEFC-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13C](=[13CH]1)Br)F |
Computed by PubChem (NCBI)