CAS 50592-33-1 is the registry number for m-Bromofluorobenzene-d4. Offered by: TRC. Available pack sizes: 50mg.
1-bromo-2,3,4,6-tetradeuterio-5-fluorobenzene (CAS 50592-33-1) is a chemical compound with the molecular formula C6H4BrF and a molecular weight of 179.02 g/mol. IUPAC name: 1-bromo-2,3,4,6-tetradeuterio-5-fluorobenzene. InChIKey: QDFKKJYEIFBEFC-RHQRLBAQSA-N.
| Molecular formula | C6H4BrF |
|---|---|
| Molecular weight | 179.02 g/mol |
| IUPAC name | 1-bromo-2,3,4,6-tetradeuterio-5-fluorobenzene |
| InChIKey | QDFKKJYEIFBEFC-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Br)[2H])F)[2H] |
Computed by PubChem (NCBI)