Products 1173020-54-6
CAS 1173020-54-6 is the registry number for Phenyl-13C6-acetic acid. Offered by: Biosynth. Available pack sizes: 5mg, 25mg, 10mg, 50mg.
2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)acetic acid (CAS 1173020-54-6) is a chemical compound with the molecular formula C8H8O2 and a molecular weight of 142.10 g/mol. IUPAC name: 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)acetic acid. InChIKey: WLJVXDMOQOGPHL-ZXJNGCBISA-N.
| Molecular formula | C8H8O2 |
|---|---|
| Molecular weight | 142.10 g/mol |
| IUPAC name | 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)acetic acid |
| InChIKey | WLJVXDMOQOGPHL-ZXJNGCBISA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)CC(=O)O |
Computed by PubChem (NCBI)