Products 65538-27-4
CAS 65538-27-4 appears in our catalog under these names: Phenylacetic-d7 Acid, 98 atom % D, min 98% Chemical Purity, Phenylacetic acid-d7. Offered by: CDN, Biosynth. Available pack sizes: 1g, 0,5g.
2,2-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid (CAS 65538-27-4) is a chemical compound with the molecular formula C8H8O2 and a molecular weight of 143.19 g/mol. IUPAC name: 2,2-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid. InChIKey: WLJVXDMOQOGPHL-XZJKGWKKSA-N.
| Molecular formula | C8H8O2 |
|---|---|
| Molecular weight | 143.19 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
| InChIKey | WLJVXDMOQOGPHL-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)