CAS 1173021-06-1 is the registry number for 3-Bromo-1-propanol-13C3. Offered by: TRC. Available pack sizes: 50mg.
3-bromo(1,2,3-13C3)propan-1-ol (CAS 1173021-06-1) is a chemical compound with the molecular formula C3H7BrO and a molecular weight of 141.97 g/mol. IUPAC name: 3-bromo(1,2,3-13C3)propan-1-ol. InChIKey: RQFUZUMFPRMVDX-VMIGTVKRSA-N.
| Molecular formula | C3H7BrO |
|---|---|
| Molecular weight | 141.97 g/mol |
| IUPAC name | 3-bromo(1,2,3-13C3)propan-1-ol |
| InChIKey | RQFUZUMFPRMVDX-VMIGTVKRSA-N |
| SMILES | [13CH2]([13CH2]O)[13CH2]Br |
Computed by PubChem (NCBI)