Products 284474-43-7
CAS 284474-43-7 appears in our catalog under these names: 3-Bromo-1-propanol-1,1,2,2,3,3-d6, 98 atom % D, min 98% Chemical Purity, 3-Bromopropan-1-ol-d6, 98.5%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10 mg, 25 mg, 100 mg, 50 mg.
3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol (CAS 284474-43-7) is a chemical compound with the molecular formula C3H7BrO and a molecular weight of 145.03 g/mol. IUPAC name: 3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol. InChIKey: RQFUZUMFPRMVDX-NMFSSPJFSA-N.
| Molecular formula | C3H7BrO |
|---|---|
| Molecular weight | 145.03 g/mol |
| IUPAC name | 3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol |
| InChIKey | RQFUZUMFPRMVDX-NMFSSPJFSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)C([2H])([2H])Br |
Computed by PubChem (NCBI)
Synonyms:
3-Bromo(~2~H_6_)propan-1-ol, 3-Bromo-1-propan-d6-ol, 3-Bromo-1-propanol-1,1,2,2,3,3-d6, 3-Bromo-1-propan-1,1,2,2,3,3-d6-ol, 3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol, 3-Bromopropan-1-ol-d6, 3-Bromopropanol-d6, 3-bromo(?H?)propan-1-ol, 3-Bromo-1-propan-d6-ol, 98 atom % D, 3-bromopropan-1,1,2,2,3,3-d6-1-ol