CAS 1173021-50-5 is the registry number for SODIUM PALMITATE-2,4,6,8,10,12,14,16-13&. Offered by: Sigma-Aldrich. Available pack sizes: 100MG, 10MG.
Sodium (2,4,6,8,10,12,14,16-13C8)hexadecanoate (CAS 1173021-50-5) is a chemical compound with the molecular formula C16H31NaO2 and a molecular weight of 286.35 g/mol. IUPAC name: sodium (2,4,6,8,10,12,14,16-13C8)hexadecanoate. InChIKey: GGXKEBACDBNFAF-CZRUWCNSSA-M.
| Molecular formula | C16H31NaO2 |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | sodium (2,4,6,8,10,12,14,16-13C8)hexadecanoate |
| InChIKey | GGXKEBACDBNFAF-CZRUWCNSSA-M |
| SMILES | [13CH3]C[13CH2]C[13CH2]C[13CH2]C[13CH2]C[13CH2]C[13CH2]C[13CH2]C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)