CAS 1173021-92-5 appears in our catalog under these names: Enrofloxacin–d5, Enrofloxacin-d5, >95% (HPLC), Enrofloxacin-d5, Enrofloxacin-d5, 99.82%. Offered by: GLPBio, TRC, TargetMol, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 5 mg, 1 mg.
1-cyclopropyl-6-fluoro-4-oxo-7-[4-(1,1,2,2,2-pentadeuterioethyl)piperazin-1-yl]quinoline-3-carboxylic acid (CAS 1173021-92-5) is a chemical compound with the molecular formula C19H22FN3O3 and a molecular weight of 364.4 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-4-oxo-7-[4-(1,1,2,2,2-pentadeuterioethyl)piperazin-1-yl]quinoline-3-carboxylic acid. InChIKey: SPFYMRJSYKOXGV-ZBJDZAJPSA-N.
| Molecular formula | C19H22FN3O3 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-(1,1,2,2,2-pentadeuterioethyl)piperazin-1-yl]quinoline-3-carboxylic acid |
| InChIKey | SPFYMRJSYKOXGV-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4CC4)F |
Computed by PubChem (NCBI)