Products 146761-69-5
CAS 146761-69-5 is the registry number for (S)-Grepafloxacin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-cyclopropyl-6-fluoro-5-methyl-7-[(3S)-3-methylpiperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (CAS 146761-69-5) is a chemical compound with the molecular formula C19H22FN3O3 and a molecular weight of 359.4 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-5-methyl-7-[(3S)-3-methylpiperazin-1-yl]-4-oxoquinoline-3-carboxylic acid. InChIKey: AIJTTZAVMXIJGM-JTQLQIEISA-N.
| Molecular formula | C19H22FN3O3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-5-methyl-7-[(3S)-3-methylpiperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| InChIKey | AIJTTZAVMXIJGM-JTQLQIEISA-N |
| SMILES | C[C@H]1CN(CCN1)C2=C(C(=C3C(=C2)N(C=C(C3=O)C(=O)O)C4CC4)C)F |
Computed by PubChem (NCBI)