Products 1173022-57-5
CAS 1173022-57-5 is the registry number for 4-TERT-OCTYLPHENOL-3,5-D2-MONOETHOXYLATE. Offered by: Sigma-Aldrich. Available pack sizes: 1ML, 10ML.
2-[3,5-dideuterio-4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol (CAS 1173022-57-5) is a chemical compound with the molecular formula C16H26O2 and a molecular weight of 252.39 g/mol. IUPAC name: 2-[3,5-dideuterio-4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol. InChIKey: JYCQQPHGFMYQCF-QFIQSOQBSA-N.
| Molecular formula | C16H26O2 |
|---|---|
| Molecular weight | 252.39 g/mol |
| IUPAC name | 2-[3,5-dideuterio-4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol |
| InChIKey | JYCQQPHGFMYQCF-QFIQSOQBSA-N |
| SMILES | [2H]C1=CC(=CC(=C1C(C)(C)CC(C)(C)C)[2H])OCCO |
Computed by PubChem (NCBI)