CAS 79-74-3 appears in our catalog under these names: 2,5–Di–tert–amylhydroquinone, 2,5-Di-tert-amylhydroquinone, >93.0%(GC), 2,5-Di-tert-pentylbenzene-1,4-diol, ≥93%(GC), ≥93%(GC), 2,5-Di-tert-pentylbenzene-1,4-diol. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g.
2,5-bis(2-methylbutan-2-yl)benzene-1,4-diol (CAS 79-74-3) is a chemical compound with the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. IUPAC name: 2,5-bis(2-methylbutan-2-yl)benzene-1,4-diol. InChIKey: CZNRFEXEPBITDS-UHFFFAOYSA-N.
| Molecular formula | C16H26O2 |
|---|---|
| Molecular weight | 250.38 g/mol |
| IUPAC name | 2,5-bis(2-methylbutan-2-yl)benzene-1,4-diol |
| InChIKey | CZNRFEXEPBITDS-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C=C1O)C(C)(C)CC)O |
Computed by PubChem (NCBI)