CAS 1173023-19-2 appears in our catalog under these names: N-Desethyl Amodiaquine-d5, >95% (HPLC), N–Desethyl amodiaquine–d5, DESETHYLAMODIAQUINE-(ETHYL-D5), >=97 AT&, N-Desethyl amodiaquine-d5, 99.9%. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1mg, 2MG, 5MG, 5 mg, 1 mg.
4-[(7-chloroquinolin-4-yl)amino]-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol (CAS 1173023-19-2) is a chemical compound with the molecular formula C18H18ClN3O and a molecular weight of 332.8 g/mol. IUPAC name: 4-[(7-chloroquinolin-4-yl)amino]-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol. InChIKey: VRXFDHAGFYWGHT-ZBJDZAJPSA-N.
| Molecular formula | C18H18ClN3O |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | 4-[(7-chloroquinolin-4-yl)amino]-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol |
| InChIKey | VRXFDHAGFYWGHT-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NCC1=C(C=CC(=C1)NC2=C3C=CC(=CC3=NC=C2)Cl)O |
Computed by PubChem (NCBI)