Products 1189455-63-7
CAS 1189455-63-7 appears in our catalog under these names: Loxapine-d8, Loxapine–d8, Loxapine-d8, 99.13%. Offered by: Chemat Brand, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
8-chloro-6-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (CAS 1189455-63-7) is a chemical compound with the molecular formula C18H18ClN3O and a molecular weight of 335.9 g/mol. IUPAC name: 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine. InChIKey: XJGVXQDUIWGIRW-JNJBWJDISA-N.
| Molecular formula | C18H18ClN3O |
|---|---|
| Molecular weight | 335.9 g/mol |
| IUPAC name | 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| InChIKey | XJGVXQDUIWGIRW-JNJBWJDISA-N |
| SMILES | [2H]C1(C(N(C(C(N1C)([2H])[2H])([2H])[2H])C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)