CAS 1173061-75-0 is the registry number for 4-Nitro-1-propylpyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
4-nitro-1-propylpyrazole (CAS 1173061-75-0) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: 4-nitro-1-propylpyrazole. InChIKey: NHCUMCWMHCBXRO-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | 4-nitro-1-propylpyrazole |
| InChIKey | NHCUMCWMHCBXRO-UHFFFAOYSA-N |
| SMILES | CCCN1C=C(C=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)