Products 893762-29-3

CAS 893762-29-3 is the registry number for (5-Ethyl-4h-1,2,4-triazol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-ethyl-1H-1,2,4-triazol-5-yl)acetic acid (CAS 893762-29-3) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: 2-(3-ethyl-1H-1,2,4-triazol-5-yl)acetic acid. InChIKey: BDYOKCOSDFEZDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3O2
Molecular weight155.15 g/mol
IUPAC name2-(3-ethyl-1H-1,2,4-triazol-5-yl)acetic acid
InChIKeyBDYOKCOSDFEZDZ-UHFFFAOYSA-N
SMILESCCC1=NNC(=N1)CC(=O)O

Computed by PubChem (NCBI)