CAS 1173103-84-8 is the registry number for AVN-211. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidine (CAS 1173103-84-8) is a chemical compound with the molecular formula C15H15N3O2S2 and a molecular weight of 333.4 g/mol. IUPAC name: 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidine. InChIKey: KSAUCBGUWGWPDL-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2S2 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidine |
| InChIKey | KSAUCBGUWGWPDL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C(C(=NN12)SC)S(=O)(=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)