Products 1649470-26-7
CAS 1649470-26-7 is the registry number for cybLuc. Offered by: Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 250mg.
(4S)-2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 1649470-26-7) is a chemical compound with the molecular formula C15H15N3O2S2 and a molecular weight of 333.4 g/mol. IUPAC name: (4S)-2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid. InChIKey: DRLXXHYUKOJAOR-LLVKDONJSA-N.
| Molecular formula | C15H15N3O2S2 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | (4S)-2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| InChIKey | DRLXXHYUKOJAOR-LLVKDONJSA-N |
| SMILES | C1CC(C1)NC2=CC3=C(C=C2)N=C(S3)C4=N[C@H](CS4)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
CybLuc, orb1697634