CAS 1173286-48-0 is the registry number for 5,5'-(9,10-Dihydrophenanthrene-2,7-diyl)diisophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[7-(3,5-dicarboxyphenyl)-9,10-dihydrophenanthren-2-yl]benzene-1,3-dicarboxylic acid (CAS 1173286-48-0) is a chemical compound with the molecular formula C30H20O8 and a molecular weight of 508.5 g/mol. IUPAC name: 5-[7-(3,5-dicarboxyphenyl)-9,10-dihydrophenanthren-2-yl]benzene-1,3-dicarboxylic acid. InChIKey: QXBMVEXBDYHBAD-UHFFFAOYSA-N.
| Molecular formula | C30H20O8 |
|---|---|
| Molecular weight | 508.5 g/mol |
| IUPAC name | 5-[7-(3,5-dicarboxyphenyl)-9,10-dihydrophenanthren-2-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | QXBMVEXBDYHBAD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C4=C1C=C(C=C4)C5=CC(=CC(=C5)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)