CAS 1351279-73-6 appears in our catalog under these names: 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetrabenzoic acid, 95%, 1,1,2,2–Tetra(4–carboxylphenyl)ethylene, 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetrabenzoic acid, 95%, 95%, 1,1,2,2-Tetra(4-carboxylphenyl)ethylene, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 10g, 5g, 25g, 100g.
4-[1,2,2-tris(4-carboxyphenyl)ethenyl]benzoic acid (CAS 1351279-73-6) is a chemical compound with the molecular formula C30H20O8 and a molecular weight of 508.5 g/mol. IUPAC name: 4-[1,2,2-tris(4-carboxyphenyl)ethenyl]benzoic acid. InChIKey: MPYOMTPWHUPLKU-UHFFFAOYSA-N.
| Molecular formula | C30H20O8 |
|---|---|
| Molecular weight | 508.5 g/mol |
| IUPAC name | 4-[1,2,2-tris(4-carboxyphenyl)ethenyl]benzoic acid |
| InChIKey | MPYOMTPWHUPLKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=C(C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)