CAS 1173334-75-2 is the registry number for 3,5-Dimethyl-1-(3-methylphenyl)-1h-pyrazole-4-carbaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(NE)-N-[[3,5-dimethyl-1-(3-methylphenyl)pyrazol-4-yl]methylidene]hydroxylamine (CAS 1173334-75-2) is a chemical compound with the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. IUPAC name: (NE)-N-[[3,5-dimethyl-1-(3-methylphenyl)pyrazol-4-yl]methylidene]hydroxylamine. InChIKey: DSJIQKWVQJXTOF-RIYZIHGNSA-N.
| Molecular formula | C13H15N3O |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | (NE)-N-[[3,5-dimethyl-1-(3-methylphenyl)pyrazol-4-yl]methylidene]hydroxylamine |
| InChIKey | DSJIQKWVQJXTOF-RIYZIHGNSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=C(C(=N2)C)/C=N/O)C |
Computed by PubChem (NCBI)