CAS 117391-53-4 appears in our catalog under these names: 3–Amino–3–(4–isopropylphenyl)propionic acid, 3-Amino-3-(4-isopropylphenyl)propionic acid, 97%, 3-Amino-3-(4-isopropylphenyl)propionic Acid, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg.
3-amino-3-(4-propan-2-ylphenyl)propanoic acid (CAS 117391-53-4) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 3-amino-3-(4-propan-2-ylphenyl)propanoic acid. InChIKey: XRDCVKSGZNDEDT-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 3-amino-3-(4-propan-2-ylphenyl)propanoic acid |
| InChIKey | XRDCVKSGZNDEDT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(CC(=O)O)N |
Computed by PubChem (NCBI)