CAS 1174005-73-2 is the registry number for 2-Chloro-6,7-dimethoxyquinolin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-6,7-dimethoxyquinolin-4-amine (CAS 1174005-73-2) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 2-chloro-6,7-dimethoxyquinolin-4-amine. InChIKey: ZTNGPDYIUBFNBJ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 2-chloro-6,7-dimethoxyquinolin-4-amine |
| InChIKey | ZTNGPDYIUBFNBJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=N2)Cl)N)OC |
Computed by PubChem (NCBI)