CAS 1174064-74-4 is the registry number for Mirtazapine Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-phenylpiperazin-1-yl)pyridine-3-carbonitrile (CAS 1174064-74-4) is a chemical compound with the molecular formula C16H16N4 and a molecular weight of 264.32 g/mol. IUPAC name: 2-(3-phenylpiperazin-1-yl)pyridine-3-carbonitrile. InChIKey: CDOFMIPVTMAIPW-UHFFFAOYSA-N.
| Molecular formula | C16H16N4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 2-(3-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
| InChIKey | CDOFMIPVTMAIPW-UHFFFAOYSA-N |
| SMILES | C1CN(CC(N1)C2=CC=CC=C2)C3=C(C=CC=N3)C#N |
Computed by PubChem (NCBI)