CAS 865658-21-5 is the registry number for 4-[4-(2,5-Dimethyl-1h-pyrrol-1-yl)phenyl]pyrimidin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[4-(2,5-dimethylpyrrol-1-yl)phenyl]pyrimidin-2-amine (CAS 865658-21-5) is a chemical compound with the molecular formula C16H16N4 and a molecular weight of 264.32 g/mol. IUPAC name: 4-[4-(2,5-dimethylpyrrol-1-yl)phenyl]pyrimidin-2-amine. InChIKey: CNHXIPNFSLPIAK-UHFFFAOYSA-N.
| Molecular formula | C16H16N4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 4-[4-(2,5-dimethylpyrrol-1-yl)phenyl]pyrimidin-2-amine |
| InChIKey | CNHXIPNFSLPIAK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)C3=NC(=NC=C3)N)C |
Computed by PubChem (NCBI)