CAS 1174338-61-4 is the registry number for potassium trifluoro(3-oxo-3-(phenylamino)propyl)borate, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
Potassium (3-anilino-3-oxopropyl)-trifluoroboranuide (CAS 1174338-61-4) is a chemical compound with the molecular formula C9H10BF3KNO and a molecular weight of 255.09 g/mol. IUPAC name: potassium (3-anilino-3-oxopropyl)-trifluoroboranuide. InChIKey: NOFRMNHZXLBZNM-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3KNO |
|---|---|
| Molecular weight | 255.09 g/mol |
| IUPAC name | potassium (3-anilino-3-oxopropyl)-trifluoroboranuide |
| InChIKey | NOFRMNHZXLBZNM-UHFFFAOYSA-N |
| SMILES | [B-](CCC(=O)NC1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)