CAS 1253046-47-7 is the registry number for Potassium (2-phenylacetyl)((trifluoro-l4-boranyl)methyl)amide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro-[[(2-phenylacetyl)amino]methyl]boranuide (CAS 1253046-47-7) is a chemical compound with the molecular formula C9H10BF3KNO and a molecular weight of 255.09 g/mol. IUPAC name: potassium trifluoro-[[(2-phenylacetyl)amino]methyl]boranuide. InChIKey: XPAFQWRLUHOFPX-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3KNO |
|---|---|
| Molecular weight | 255.09 g/mol |
| IUPAC name | potassium trifluoro-[[(2-phenylacetyl)amino]methyl]boranuide |
| InChIKey | XPAFQWRLUHOFPX-UHFFFAOYSA-N |
| SMILES | [B-](CNC(=O)CC1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)