Products 1174638-31-3
CAS 1174638-31-3 is the registry number for N-Cyclopropyl-4-methyl-N-(phenylethynyl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-cyclopropyl-4-methyl-N-(2-phenylethynyl)benzenesulfonamide (CAS 1174638-31-3) is a chemical compound with the molecular formula C18H17NO2S and a molecular weight of 311.4 g/mol. IUPAC name: N-cyclopropyl-4-methyl-N-(2-phenylethynyl)benzenesulfonamide. InChIKey: GGGUFPNIXHZXMB-UHFFFAOYSA-N.
| Molecular formula | C18H17NO2S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | N-cyclopropyl-4-methyl-N-(2-phenylethynyl)benzenesulfonamide |
| InChIKey | GGGUFPNIXHZXMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C#CC2=CC=CC=C2)C3CC3 |
Computed by PubChem (NCBI)