CAS 1707372-65-3 is the registry number for 7-Methyl-3-[2-(phenylsulfinyl)ethyl]quinolin-2(1h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3-[2-(benzenesulfinyl)ethyl]-7-methyl-1H-quinolin-2-one (CAS 1707372-65-3) is a chemical compound with the molecular formula C18H17NO2S and a molecular weight of 311.4 g/mol. IUPAC name: 3-[2-(benzenesulfinyl)ethyl]-7-methyl-1H-quinolin-2-one. InChIKey: YHKBAHSVISNCFO-UHFFFAOYSA-N.
| Molecular formula | C18H17NO2S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 3-[2-(benzenesulfinyl)ethyl]-7-methyl-1H-quinolin-2-one |
| InChIKey | YHKBAHSVISNCFO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C(=O)N2)CCS(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)