CAS 172902-25-9 is the registry number for 2-(4-Chloro-6-methylpyrimidin-2-yl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(4-chloro-6-methylpyrimidin-2-yl)phenol (CAS 172902-25-9) is a chemical compound with the molecular formula C11H9ClN2O and a molecular weight of 220.65 g/mol. IUPAC name: 2-(4-chloro-6-methylpyrimidin-2-yl)phenol. InChIKey: SSJTVFAVNGBQDX-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 2-(4-chloro-6-methylpyrimidin-2-yl)phenol |
| InChIKey | SSJTVFAVNGBQDX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C2=CC=CC=C2O)Cl |
Computed by PubChem (NCBI)