CAS 117467-73-9 appears in our catalog under these names: Cbz-4-fluoro-d-phe, 95%, Z-D-Phe(4-F)-OH, 98%, Z–4–fluoro–D–phenylalanine, Z-D-Phe(4-F)-OH, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g, 100g.
(2R)-3-(4-fluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 117467-73-9) is a chemical compound with the molecular formula C17H16FNO4 and a molecular weight of 317.31 g/mol. IUPAC name: (2R)-3-(4-fluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: YJSNXFAVHKHBPV-OAHLLOKOSA-N.
| Molecular formula | C17H16FNO4 |
|---|---|
| Molecular weight | 317.31 g/mol |
| IUPAC name | (2R)-3-(4-fluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | YJSNXFAVHKHBPV-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)