CAS 127862-88-8 appears in our catalog under these names: (S)–2–(((Benzyloxy)carbonyl)amino)–3–(2–fluorophenyl)propanoic acid, Cbz-Phe(2-F)-OH 95%, (S)-2-(((Benzyloxy)carbonyl)amino)-3-(2-fluorophenyl)propanoic acid, 97%, 97%, (S)-2-(((Benzyloxy)carbonyl)amino)-3-(2-fluorophenyl)propanoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2S)-3-(2-fluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 127862-88-8) is a chemical compound with the molecular formula C17H16FNO4 and a molecular weight of 317.31 g/mol. IUPAC name: (2S)-3-(2-fluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: GYJREHMTTLYKRJ-HNNXBMFYSA-N.
| Molecular formula | C17H16FNO4 |
|---|---|
| Molecular weight | 317.31 g/mol |
| IUPAC name | (2S)-3-(2-fluorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | GYJREHMTTLYKRJ-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)