CAS 117480-53-2 is the registry number for 3-Hydrazinyl-8-methyl-5h-[1,2,4]triazino[5,6-b]indole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine (CAS 117480-53-2) is a chemical compound with the molecular formula C10H10N6 and a molecular weight of 214.23 g/mol. IUPAC name: (8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine. InChIKey: QNIGVTNBJSLTIS-UHFFFAOYSA-N.
| Molecular formula | C10H10N6 |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | (8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine |
| InChIKey | QNIGVTNBJSLTIS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2N=NC(=N3)NN |
Computed by PubChem (NCBI)