CAS 330446-16-7 appears in our catalog under these names: 3-Hydrazino-6-methyl-5h-[1,2,4]triazino[5,6-b]indole, 95%, 3-Hydrazino-6-methyl-5H-(1,2,4)triazino(5,6-b)indole, 95%, 3-Hydrazinyl-6-methyl-5H-(1,2,4)triazino(5,6-b)indole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine (CAS 330446-16-7) is a chemical compound with the molecular formula C10H10N6 and a molecular weight of 214.23 g/mol. IUPAC name: (6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine. InChIKey: IENCLQAXYAPTJO-UHFFFAOYSA-N.
| Molecular formula | C10H10N6 |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | (6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine |
| InChIKey | IENCLQAXYAPTJO-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C3=C(N2)N=C(N=N3)NN |
Computed by PubChem (NCBI)