Products 1175087-38-3
CAS 1175087-38-3 is the registry number for Ethyl 2-methyl-3-(pyridin-2-yl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 0,05g, 0,5g.
Ethyl (E)-2-methyl-3-pyridin-2-ylprop-2-enoate (CAS 1175087-38-3) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: ethyl (E)-2-methyl-3-pyridin-2-ylprop-2-enoate. InChIKey: WUOWSMMMIWBRDY-CMDGGOBGSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | ethyl (E)-2-methyl-3-pyridin-2-ylprop-2-enoate |
| InChIKey | WUOWSMMMIWBRDY-CMDGGOBGSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=CC=N1)/C |
Computed by PubChem (NCBI)