CAS 1175534-92-5 is the registry number for 5-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,3-thiazole (CAS 1175534-92-5) is a chemical compound with the molecular formula C8H12BNO2S and a molecular weight of 197.07 g/mol. IUPAC name: 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,3-thiazole. InChIKey: JKUAXIFBQYHICI-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2S |
|---|---|
| Molecular weight | 197.07 g/mol |
| IUPAC name | 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,3-thiazole |
| InChIKey | JKUAXIFBQYHICI-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CN=CS2 |
Computed by PubChem (NCBI)