CAS 1175648-47-1 appears in our catalog under these names: 2-Chloro-N-cyclopropyl-N-{(4-(propan-2-yl)phenyl)methyl}acetamide, 95%, 2-Chloro-N-cyclopropyl-N-{(4-(propan-2-yl)phenyl)methyl}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-chloro-N-cyclopropyl-N-[(4-propan-2-ylphenyl)methyl]acetamide (CAS 1175648-47-1) is a chemical compound with the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. IUPAC name: 2-chloro-N-cyclopropyl-N-[(4-propan-2-ylphenyl)methyl]acetamide. InChIKey: ZSWOIRJDKWRORX-UHFFFAOYSA-N.
| Molecular formula | C15H20ClNO |
|---|---|
| Molecular weight | 265.78 g/mol |
| IUPAC name | 2-chloro-N-cyclopropyl-N-[(4-propan-2-ylphenyl)methyl]acetamide |
| InChIKey | ZSWOIRJDKWRORX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CN(C2CC2)C(=O)CCl |
Computed by PubChem (NCBI)