CAS 731833-60-6 is the registry number for 2-Chloro-1-(2,2,4,7-tetramethyl-3,4-dihydro-2H-quinolin-1-yl)-ethanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)ethanone (CAS 731833-60-6) is a chemical compound with the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. IUPAC name: 2-chloro-1-(2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)ethanone. InChIKey: VEFBUBYOMNKMMO-UHFFFAOYSA-N.
| Molecular formula | C15H20ClNO |
|---|---|
| Molecular weight | 265.78 g/mol |
| IUPAC name | 2-chloro-1-(2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)ethanone |
| InChIKey | VEFBUBYOMNKMMO-UHFFFAOYSA-N |
| SMILES | CC1CC(N(C2=C1C=CC(=C2)C)C(=O)CCl)(C)C |
Computed by PubChem (NCBI)