Products 117568-32-8
CAS 117568-32-8 is the registry number for Flavidulols A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6E,10Z)-4-methoxy-7,11-dimethyl-5,8,9,12-tetrahydrobenzo[10]annulen-1-ol (CAS 117568-32-8) is a chemical compound with the molecular formula C17H22O2 and a molecular weight of 258.35 g/mol. IUPAC name: (6E,10Z)-4-methoxy-7,11-dimethyl-5,8,9,12-tetrahydrobenzo[10]annulen-1-ol. InChIKey: SZKZGGBNARQQFB-XGFOSXQASA-N.
| Molecular formula | C17H22O2 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | (6E,10Z)-4-methoxy-7,11-dimethyl-5,8,9,12-tetrahydrobenzo[10]annulen-1-ol |
| InChIKey | SZKZGGBNARQQFB-XGFOSXQASA-N |
| SMILES | C/C/1=C\CC2=C(C=CC(=C2C/C(=C\CC1)/C)O)OC |
Computed by PubChem (NCBI)