CAS 1175888-09-1 is the registry number for tert-Butyl (4S,5R)-4-(bromomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (4S,5R)-4-(bromomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (CAS 1175888-09-1) is a chemical compound with the molecular formula C12H22BrNO3 and a molecular weight of 308.21 g/mol. IUPAC name: tert-butyl (4S,5R)-4-(bromomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: VEULXYRJGBJWFF-RKDXNWHRSA-N.
| Molecular formula | C12H22BrNO3 |
|---|---|
| Molecular weight | 308.21 g/mol |
| IUPAC name | tert-butyl (4S,5R)-4-(bromomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | VEULXYRJGBJWFF-RKDXNWHRSA-N |
| SMILES | C[C@@H]1[C@H](N(C(O1)(C)C)C(=O)OC(C)(C)C)CBr |
Computed by PubChem (NCBI)