CAS 2375247-89-3 appears in our catalog under these names: tert-Butyl (R)-6-(bromomethyl)-2,2-dimethylmorpholine-4-carboxylate, 98%, tert-Butyl (6R)-6-(bromomethyl)-2,2-dimethylmorpholine-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
Tert-butyl (6R)-6-(bromomethyl)-2,2-dimethylmorpholine-4-carboxylate (CAS 2375247-89-3) is a chemical compound with the molecular formula C12H22BrNO3 and a molecular weight of 308.21 g/mol. IUPAC name: tert-butyl (6R)-6-(bromomethyl)-2,2-dimethylmorpholine-4-carboxylate. InChIKey: ZVAAIMGEJNOJEF-VIFPVBQESA-N.
| Molecular formula | C12H22BrNO3 |
|---|---|
| Molecular weight | 308.21 g/mol |
| IUPAC name | tert-butyl (6R)-6-(bromomethyl)-2,2-dimethylmorpholine-4-carboxylate |
| InChIKey | ZVAAIMGEJNOJEF-VIFPVBQESA-N |
| SMILES | CC1(CN(C[C@@H](O1)CBr)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)