Products 1175985-72-4
CAS 1175985-72-4 is the registry number for (1S)-1-(5-Chloro-2,4-dimethoxyphenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S)-1-(5-chloro-2,4-dimethoxyphenyl)ethanol (CAS 1175985-72-4) is a chemical compound with the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. IUPAC name: (1S)-1-(5-chloro-2,4-dimethoxyphenyl)ethanol. InChIKey: IMTBCHYABOCEOK-LURJTMIESA-N.
| Molecular formula | C10H13ClO3 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | (1S)-1-(5-chloro-2,4-dimethoxyphenyl)ethanol |
| InChIKey | IMTBCHYABOCEOK-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1OC)OC)Cl)O |
Computed by PubChem (NCBI)