Products 1176053-13-6
CAS 1176053-13-6 is the registry number for 4-(4-Ethylphenyl)-1H-imidazol-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(4-ethylphenyl)-1H-imidazol-2-amine (CAS 1176053-13-6) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 5-(4-ethylphenyl)-1H-imidazol-2-amine. InChIKey: QYLKOBLBRLVHCG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 5-(4-ethylphenyl)-1H-imidazol-2-amine |
| InChIKey | QYLKOBLBRLVHCG-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CN=C(N2)N |
Computed by PubChem (NCBI)