CAS 1176273-16-7 is the registry number for 2-Oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl methacrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl] 2-methylprop-2-enoate (CAS 1176273-16-7) is a chemical compound with the molecular formula C9H9F5O4 and a molecular weight of 276.16 g/mol. IUPAC name: [2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl] 2-methylprop-2-enoate. InChIKey: QLXPCOBCFPUQGK-UHFFFAOYSA-N.
| Molecular formula | C9H9F5O4 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | [2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl] 2-methylprop-2-enoate |
| InChIKey | QLXPCOBCFPUQGK-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(=O)OCC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)