CAS 938459-25-7 appears in our catalog under these names: 2-[(Pentafluoropropanoyl)oxy]ethyl methacrylate, 95%, 2-((2,2,3,3,3-Pentafluoropropanoyl)oxy)ethyl methacrylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g, 100g.
2-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl 2-methylprop-2-enoate (CAS 938459-25-7) is a chemical compound with the molecular formula C9H9F5O4 and a molecular weight of 276.16 g/mol. IUPAC name: 2-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl 2-methylprop-2-enoate. InChIKey: YJQICTHKIWCNDO-UHFFFAOYSA-N.
| Molecular formula | C9H9F5O4 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | 2-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl 2-methylprop-2-enoate |
| InChIKey | YJQICTHKIWCNDO-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOC(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)