CAS 117657-38-2 is the registry number for N-BOC-2,4-dibromopyrrole. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Tert-butyl 2,5-dibromopyrrole-1-carboxylate (CAS 117657-38-2) is a chemical compound with the molecular formula C9H11Br2NO2 and a molecular weight of 325.00 g/mol. IUPAC name: tert-butyl 2,5-dibromopyrrole-1-carboxylate. InChIKey: NTGSPDLQYRAXAK-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2NO2 |
|---|---|
| Molecular weight | 325.00 g/mol |
| IUPAC name | tert-butyl 2,5-dibromopyrrole-1-carboxylate |
| InChIKey | NTGSPDLQYRAXAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=CC=C1Br)Br |
Computed by PubChem (NCBI)