Products 1909316-31-9

CAS 1909316-31-9 is the registry number for Ethyl 6-(bromomethyl)pyridine-3-carboxylate hydrobromide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 6-(bromomethyl)pyridine-3-carboxylate;hydrobromide (CAS 1909316-31-9) is a chemical compound with the molecular formula C9H11Br2NO2 and a molecular weight of 325.00 g/mol. IUPAC name: ethyl 6-(bromomethyl)pyridine-3-carboxylate;hydrobromide. InChIKey: QIKLKOHXIAAJCG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11Br2NO2
Molecular weight325.00 g/mol
IUPAC nameethyl 6-(bromomethyl)pyridine-3-carboxylate;hydrobromide
InChIKeyQIKLKOHXIAAJCG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C(C=C1)CBr.Br

Computed by PubChem (NCBI)