Products 1176657-14-9
CAS 1176657-14-9 is the registry number for 1,4-Dimethyl 2-[[(2S)-2-pyrrolidinylcarbonyl]amino]-1,4-benzenedicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Dimethyl 2-[[(2S)-pyrrolidine-2-carbonyl]amino]benzene-1,4-dicarboxylate (CAS 1176657-14-9) is a chemical compound with the molecular formula C15H18N2O5 and a molecular weight of 306.31 g/mol. IUPAC name: dimethyl 2-[[(2S)-pyrrolidine-2-carbonyl]amino]benzene-1,4-dicarboxylate. InChIKey: CBBYDNNLAFVWKP-NSHDSACASA-N.
| Molecular formula | C15H18N2O5 |
|---|---|
| Molecular weight | 306.31 g/mol |
| IUPAC name | dimethyl 2-[[(2S)-pyrrolidine-2-carbonyl]amino]benzene-1,4-dicarboxylate |
| InChIKey | CBBYDNNLAFVWKP-NSHDSACASA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)NC(=O)[C@@H]2CCCN2 |
Computed by PubChem (NCBI)