CAS 117668-29-8 is the registry number for 1-Cyanoisoquinoline-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-cyanoisoquinoline-4-carboxylic acid (CAS 117668-29-8) is a chemical compound with the molecular formula C11H6N2O2 and a molecular weight of 198.18 g/mol. IUPAC name: 1-cyanoisoquinoline-4-carboxylic acid. InChIKey: ZZMCGWNHOMZDSD-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O2 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | 1-cyanoisoquinoline-4-carboxylic acid |
| InChIKey | ZZMCGWNHOMZDSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2C#N)C(=O)O |
Computed by PubChem (NCBI)