CAS 4496-30-4 is the registry number for 1H-Naphtho[2,3-d]imidazole-4,9-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1H-benzo[f]benzimidazole-4,9-dione (CAS 4496-30-4) is a chemical compound with the molecular formula C11H6N2O2 and a molecular weight of 198.18 g/mol. IUPAC name: 1H-benzo[f]benzimidazole-4,9-dione. InChIKey: ABVGDXLCJRFCOD-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O2 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | 1H-benzo[f]benzimidazole-4,9-dione |
| InChIKey | ABVGDXLCJRFCOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)N=CN3 |
Computed by PubChem (NCBI)